C20H19N3O3S2 — CID 24818281
2-phenylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide (PubChem CID 24818281) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | 2-phenylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24818281 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-phenylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]pyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cccnc1Sc1ccccc1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-14(15-9-11-17(12-10-15)28(21,25)26)23-19(24)18-8-5-13-22-20(18)27-16-6-3-2-4-7-16/h2-14H,1H3,(H,23,24)(H2,21,25,26) |
| InChIKey | JXAVSXLYUWPLSH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |