C18H33N7O2 — CID 24819328
4-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-(2-morpholin-4-ylethyl)butanamide (PubChem CID 24819328) has the molecular formula C18H33N7O2 and a molecular weight of 379.51 g/mol. Its IUPAC name is 4-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-(2-morpholin-4-ylethyl)butanamide.
| Compound Name | 4-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-(2-morpholin-4-ylethyl)butanamide |
|---|---|
| PubChem CID | 24819328 |
| Molecular Formula | C18H33N7O2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 4-[5-[(4-methylpiperidin-1-yl)methyl]tetrazol-1-yl]-N-(2-morpholin-4-ylethyl)butanamide |
| SMILES | CC1CCN(Cc2nnnn2CCCC(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C18H33N7O2/c1-16-4-8-24(9-5-16)15-17-20-21-22-25(17)7-2-3-18(26)19-6-10-23-11-13-27-14-12-23/h16H,2-15H2,1H3,(H,19,26) |
| InChIKey | KGDPLNBNSSYNIA-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |