C17H25N7O2 — CID 72923800
N-[(3-methyl-4-pyridinyl)methyl]-4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]butanamide (PubChem CID 72923800) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[(3-methyl-4-pyridinyl)methyl]-4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]butanamide.
| Compound Name | N-[(3-methyl-4-pyridinyl)methyl]-4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]butanamide |
|---|---|
| PubChem CID | 72923800 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-[(3-methyl-4-pyridinyl)methyl]-4-[5-(morpholin-4-ylmethyl)tetrazol-1-yl]butanamide |
| SMILES | Cc1cnccc1CNC(=O)CCCn1nnnc1CN1CCOCC1 |
| InChI | InChI=1S/C17H25N7O2/c1-14-11-18-5-4-15(14)12-19-17(25)3-2-6-24-16(20-21-22-24)13-23-7-9-26-10-8-23/h4-5,11H,2-3,6-10,12-13H2,1H3,(H,19,25) |
| InChIKey | VWIRGEPKGUZQBN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |