C30H28FNO3 — CID 24821495
5-fluoro-2-[[4-[3-[(N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzoic acid (PubChem CID 24821495) has the molecular formula C30H28FNO3 and a molecular weight of 469.56 g/mol. Its IUPAC name is 5-fluoro-2-[[4-[3-[(N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzoic acid.
| Compound Name | 5-fluoro-2-[[4-[3-[(N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 24821495 |
| Molecular Formula | C30H28FNO3 |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 5-fluoro-2-[[4-[3-[(N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzoic acid |
| SMILES | CC(C)N(Cc1cccc(-c2ccc(OCc3ccc(F)cc3C(=O)O)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C30H28FNO3/c1-21(2)32(27-9-4-3-5-10-27)19-22-7-6-8-24(17-22)23-12-15-28(16-13-23)35-20-25-11-14-26(31)18-29(25)30(33)34/h3-18,21H,19-20H2,1-2H3,(H,33,34) |
| InChIKey | BWPSCKREMAYQFE-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |