C35H38FNO2 — CID 143643859
2-fluoro-6-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde (PubChem CID 143643859) has the molecular formula C35H38FNO2 and a molecular weight of 523.69 g/mol. Its IUPAC name is 2-fluoro-6-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde.
| Compound Name | 2-fluoro-6-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde |
|---|---|
| PubChem CID | 143643859 |
| Molecular Formula | C35H38FNO2 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 2-fluoro-6-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde |
| SMILES | CCC(CC)c1ccc(N(Cc2cccc(-c3ccc(OCc4cccc(F)c4C=O)cc3)c2)C(C)C)cc1 |
| InChI | InChI=1S/C35H38FNO2/c1-5-27(6-2)28-13-17-32(18-14-28)37(25(3)4)22-26-9-7-10-30(21-26)29-15-19-33(20-16-29)39-24-31-11-8-12-35(36)34(31)23-38/h7-21,23,25,27H,5-6,22,24H2,1-4H3 |
| InChIKey | PEKYQBGEHKHXMP-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|