C31H39NO2S — CID 24821700
3-[[3-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenyl]methylsulfanyl]propanoic acid (PubChem CID 24821700) has the molecular formula C31H39NO2S and a molecular weight of 489.73 g/mol. Its IUPAC name is 3-[[3-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | 3-[[3-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 24821700 |
| Molecular Formula | C31H39NO2S |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 3-[[3-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenyl]methylsulfanyl]propanoic acid |
| SMILES | CCC(CC)c1ccc(N(Cc2cccc(-c3cccc(CSCCC(=O)O)c3)c2)C(C)C)cc1 |
| InChI | InChI=1S/C31H39NO2S/c1-5-26(6-2)27-13-15-30(16-14-27)32(23(3)4)21-24-9-7-11-28(19-24)29-12-8-10-25(20-29)22-35-18-17-31(33)34/h7-16,19-20,23,26H,5-6,17-18,21-22H2,1-4H3,(H,33,34) |
| InChIKey | RHOFRPCCRWEAQM-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|