C36H41NO3 — CID 143643898
3-methoxy-5-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde (PubChem CID 143643898) has the molecular formula C36H41NO3 and a molecular weight of 535.73 g/mol. Its IUPAC name is 3-methoxy-5-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde.
| Compound Name | 3-methoxy-5-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde |
|---|---|
| PubChem CID | 143643898 |
| Molecular Formula | C36H41NO3 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 3-methoxy-5-[[4-[3-[(4-pentan-3-yl-N-propan-2-ylanilino)methyl]phenyl]phenoxy]methyl]benzaldehyde |
| SMILES | CCC(CC)c1ccc(N(Cc2cccc(-c3ccc(OCc4cc(C=O)cc(OC)c4)cc3)c2)C(C)C)cc1 |
| InChI | InChI=1S/C36H41NO3/c1-6-30(7-2)31-11-15-34(16-12-31)37(26(3)4)23-27-9-8-10-33(20-27)32-13-17-35(18-14-32)40-25-29-19-28(24-38)21-36(22-29)39-5/h8-22,24,26,30H,6-7,23,25H2,1-5H3 |
| InChIKey | JBQMXIMZOYMYPW-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|