About bis(3-methoxypropyl) (E)-but-2-enedioate
bis(3-methoxypropyl) (E)-but-2-enedioate (PubChem CID 24821666) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is bis(3-methoxypropyl) (E)-but-2-enedioate.
Molecular Properties
| Compound Name | bis(3-methoxypropyl) (E)-but-2-enedioate |
| PubChem CID | 24821666 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | bis(3-methoxypropyl) (E)-but-2-enedioate |
| SMILES | COCCCOC(=O)/C=C/C(=O)OCCCOC |
| InChI | InChI=1S/C12H20O6/c1-15-7-3-9-17-11(13)5-6-12(14)18-10-4-8-16-2/h5-6H,3-4,7-10H2,1-2H3/b6-5+ |
| InChIKey | HDHTXZGMFTYDJE-AATRIKPKSA-N |
| XLogP | 0.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methoxypropyl) (E)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methoxypropyl) (E)-but-2-enedioate?
The IUPAC name of bis(3-methoxypropyl) (E)-but-2-enedioate (CID 24821666) is bis(3-methoxypropyl) (E)-but-2-enedioate.
What is the SMILES notation for bis(3-methoxypropyl) (E)-but-2-enedioate?
The canonical SMILES for bis(3-methoxypropyl) (E)-but-2-enedioate is COCCCOC(=O)/C=C/C(=O)OCCCOC.
What is the InChIKey of bis(3-methoxypropyl) (E)-but-2-enedioate?
The InChIKey is HDHTXZGMFTYDJE-AATRIKPKSA-N. The full InChI is InChI=1S/C12H20O6/c1-15-7-3-9-17-11(13)5-6-12(14)18-10-4-8-16-2/h5-6H,3-4,7-10H2,1-2H3/b6-5+.
What are the key properties of bis(3-methoxypropyl) (E)-but-2-enedioate?
bis(3-methoxypropyl) (E)-but-2-enedioate has a molecular weight of 260.29 g/mol, XLogP of 0.70, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methoxypropyl) (E)-but-2-enedioate is sourced from PubChem (CID 24821666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).