C21H22N2O5 — CID 24822077
4-[2-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-2-methoxyphenol (PubChem CID 24822077) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[2-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-2-methoxyphenol.
| Compound Name | 4-[2-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 24822077 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 4-[2-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]-2-methoxyphenol |
| SMILES | COc1cc(-c2cc(-c3cc(OC)c(OC)c(OC)c3)cnc2N)ccc1O |
| InChI | InChI=1S/C21H22N2O5/c1-25-17-8-12(5-6-16(17)24)15-7-14(11-23-21(15)22)13-9-18(26-2)20(28-4)19(10-13)27-3/h5-11,24H,1-4H3,(H2,22,23) |
| InChIKey | GUBPYJJIGUBALI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |