C14H11ClN4O2S — CID 24822437
2-chloro-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide (PubChem CID 24822437) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is 2-chloro-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide.
| Compound Name | 2-chloro-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 24822437 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-chloro-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide |
| SMILES | Cc1ccc(-c2nc(NC(=O)CCl)cc(-c3nccs3)n2)o1 |
| InChI | InChI=1S/C14H11ClN4O2S/c1-8-2-3-10(21-8)13-17-9(14-16-4-5-22-14)6-11(19-13)18-12(20)7-15/h2-6H,7H2,1H3,(H,17,18,19,20) |
| InChIKey | VRERKECNUNRLLB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|