C24H25N5O4S — CID 24739975
2-[3-[(2-methoxyethylamino)methyl]phenoxy]-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide (PubChem CID 24739975) has the molecular formula C24H25N5O4S and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[3-[(2-methoxyethylamino)methyl]phenoxy]-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide.
| Compound Name | 2-[3-[(2-methoxyethylamino)methyl]phenoxy]-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 24739975 |
| Molecular Formula | C24H25N5O4S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-[3-[(2-methoxyethylamino)methyl]phenoxy]-N-[2-(5-methylfuran-2-yl)-6-(1,3-thiazol-2-yl)pyrimidin-4-yl]acetamide |
| SMILES | COCCNCc1cccc(OCC(=O)Nc2cc(-c3nccs3)nc(-c3ccc(C)o3)n2)c1 |
| InChI | InChI=1S/C24H25N5O4S/c1-16-6-7-20(33-16)23-27-19(24-26-9-11-34-24)13-21(29-23)28-22(30)15-32-18-5-3-4-17(12-18)14-25-8-10-31-2/h3-7,9,11-13,25H,8,10,14-15H2,1-2H3,(H,27,28,29,30) |
| InChIKey | BCQOEJUZAWAUBU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|