C29H50BNO6 — CID 24824289
tert-butyl (4R,5S)-5-[(2S,3R,4R,5E,7E,9E)-3-hydroxy-4,7-dimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 24824289) has the molecular formula C29H50BNO6 and a molecular weight of 519.53 g/mol. Its IUPAC name is tert-butyl (4R,5S)-5-[(2S,3R,4R,5E,7E,9E)-3-hydroxy-4,7-dimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5S)-5-[(2S,3R,4R,5E,7E,9E)-3-hydroxy-4,7-dimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 24824289 |
| Molecular Formula | C29H50BNO6 |
| Molecular Weight | 519.53 g/mol |
| Exact Mass | 519.37 |
| IUPAC Name | tert-butyl (4R,5S)-5-[(2S,3R,4R,5E,7E,9E)-3-hydroxy-4,7-dimethyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-5,7,9-trien-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(/C=C/[C@@H](C)[C@@H](O)[C@H](C)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1C)=C\C=C\B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H50BNO6/c1-19(15-14-18-30-36-27(8,9)28(10,11)37-30)16-17-20(2)23(32)21(3)24-22(4)31(29(12,13)34-24)25(33)35-26(5,6)7/h14-18,20-24,32H,1-13H3/b17-16+,18-14+,19-15+/t20-,21+,22-,23-,24+/m1/s1 |
| InChIKey | SJQJIXOHOXFDRF-GLVQTNOUSA-N |
| XLogP | 6.07 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|