C25H35N5O3S2 — CID 24825365
N-[2-[4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazol-5-yl]ethyl]-4-pentylpiperazine-1-sulfonamide (PubChem CID 24825365) has the molecular formula C25H35N5O3S2 and a molecular weight of 517.72 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazol-5-yl]ethyl]-4-pentylpiperazine-1-sulfonamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazol-5-yl]ethyl]-4-pentylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 24825365 |
| Molecular Formula | C25H35N5O3S2 |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)-2-thiophen-2-yl-1H-imidazol-5-yl]ethyl]-4-pentylpiperazine-1-sulfonamide |
| SMILES | CCCCCN1CCN(S(=O)(=O)NCCc2[nH]c(-c3cccs3)nc2-c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H35N5O3S2/c1-3-4-5-14-29-15-17-30(18-16-29)35(31,32)26-13-12-22-24(20-8-10-21(33-2)11-9-20)28-25(27-22)23-7-6-19-34-23/h6-11,19,26H,3-5,12-18H2,1-2H3,(H,27,28) |
| InChIKey | XOMUQLAAMXZNKY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|