C30H41N — CID 24825439
(3aS,6aR)-N-(4-tert-butylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine (PubChem CID 24825439) has the molecular formula C30H41N and a molecular weight of 415.67 g/mol. Its IUPAC name is (3aS,6aR)-N-(4-tert-butylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine.
| Compound Name | (3aS,6aR)-N-(4-tert-butylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
|---|---|
| PubChem CID | 24825439 |
| Molecular Formula | C30H41N |
| Molecular Weight | 415.67 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | (3aS,6aR)-N-(4-tert-butylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
| SMILES | CCCCCCC1=C(c2ccccc2)[C@]2(Nc3ccc(C(C)(C)C)cc3)CCC[C@@H]2C1 |
| InChI | InChI=1S/C30H41N/c1-5-6-7-9-15-24-22-26-16-12-21-30(26,28(24)23-13-10-8-11-14-23)31-27-19-17-25(18-20-27)29(2,3)4/h8,10-11,13-14,17-20,26,31H,5-7,9,12,15-16,21-22H2,1-4H3/t26-,30+/m1/s1 |
| InChIKey | QAJWNVMZUPLQGY-VIZCGCQYSA-N |
| XLogP | 8.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.67 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|