C14H18N4OS — CID 24826060
4-methyl-N-(4-piperidin-4-yloxy-2-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 24826060) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 4-methyl-N-(4-piperidin-4-yloxy-2-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-(4-piperidin-4-yloxy-2-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 24826060 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 4-methyl-N-(4-piperidin-4-yloxy-2-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | Cc1csc(Nc2cc(OC3CCNCC3)ccn2)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-10-9-20-14(17-10)18-13-8-12(4-7-16-13)19-11-2-5-15-6-3-11/h4,7-9,11,15H,2-3,5-6H2,1H3,(H,16,17,18) |
| InChIKey | ZACTYMQAAGNBEK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |