C13H16N4S — CID 73439798
4-methyl-N-(6-pyrrolidin-2-yl-2-pyridinyl)-1,3-thiazol-2-amine (PubChem CID 73439798) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is 4-methyl-N-(6-pyrrolidin-2-yl-2-pyridinyl)-1,3-thiazol-2-amine.
| Compound Name | 4-methyl-N-(6-pyrrolidin-2-yl-2-pyridinyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 73439798 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-methyl-N-(6-pyrrolidin-2-yl-2-pyridinyl)-1,3-thiazol-2-amine |
| SMILES | Cc1csc(Nc2cccc(C3CCCN3)n2)n1 |
| InChI | InChI=1S/C13H16N4S/c1-9-8-18-13(15-9)17-12-6-2-4-11(16-12)10-5-3-7-14-10/h2,4,6,8,10,14H,3,5,7H2,1H3,(H,15,16,17) |
| InChIKey | JVRXFYXUITXVRU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |