C14H21N3O — CID 95846768
N-(oxan-4-yl)-6-[(2S)-pyrrolidin-2-yl]pyridin-2-amine (PubChem CID 95846768) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is N-(oxan-4-yl)-6-[(2S)-pyrrolidin-2-yl]pyridin-2-amine.
| Compound Name | N-(oxan-4-yl)-6-[(2S)-pyrrolidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 95846768 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | N-(oxan-4-yl)-6-[(2S)-pyrrolidin-2-yl]pyridin-2-amine |
| SMILES | c1cc(NC2CCOCC2)nc([C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C14H21N3O/c1-3-13(12-4-2-8-15-12)17-14(5-1)16-11-6-9-18-10-7-11/h1,3,5,11-12,15H,2,4,6-10H2,(H,16,17)/t12-/m0/s1 |
| InChIKey | FUBDYPWKSNJSKG-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |