C22H15Cl2N5O2 — CID 24828386
6-chloro-N-[4-[(4-chlorophenyl)carbamoyl]-1-phenylpyrazol-5-yl]pyridine-3-carboxamide (PubChem CID 24828386) has the molecular formula C22H15Cl2N5O2 and a molecular weight of 452.30 g/mol. Its IUPAC name is 6-chloro-N-[4-[(4-chlorophenyl)carbamoyl]-1-phenylpyrazol-5-yl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[4-[(4-chlorophenyl)carbamoyl]-1-phenylpyrazol-5-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24828386 |
| Molecular Formula | C22H15Cl2N5O2 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 6-chloro-N-[4-[(4-chlorophenyl)carbamoyl]-1-phenylpyrazol-5-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(C(=O)Nc2ccc(Cl)cc2)cnn1-c1ccccc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C22H15Cl2N5O2/c23-15-7-9-16(10-8-15)27-22(31)18-13-26-29(17-4-2-1-3-5-17)20(18)28-21(30)14-6-11-19(24)25-12-14/h1-13H,(H,27,31)(H,28,30) |
| InChIKey | ZGFWCLACBHZERW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|