C24H22ClN3O2S2 — CID 2482973
10-[(4-chlorophenyl)sulfanylmethyl]-N-(3,5-dimethoxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 2482973) has the molecular formula C24H22ClN3O2S2 and a molecular weight of 484.05 g/mol. Its IUPAC name is 10-[(4-chlorophenyl)sulfanylmethyl]-N-(3,5-dimethoxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 10-[(4-chlorophenyl)sulfanylmethyl]-N-(3,5-dimethoxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 2482973 |
| Molecular Formula | C24H22ClN3O2S2 |
| Molecular Weight | 484.05 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 10-[(4-chlorophenyl)sulfanylmethyl]-N-(3,5-dimethoxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | COc1cc(Nc2nc(CSc3ccc(Cl)cc3)nc3sc4c(c23)CCC4)cc(OC)c1 |
| InChI | InChI=1S/C24H22ClN3O2S2/c1-29-16-10-15(11-17(12-16)30-2)26-23-22-19-4-3-5-20(19)32-24(22)28-21(27-23)13-31-18-8-6-14(25)7-9-18/h6-12H,3-5,13H2,1-2H3,(H,26,27,28) |
| InChIKey | SWOMLCONRAKLEU-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.05 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |