C22H17Cl2N3S — CID 91965898
10-benzyl-N-(2,4-dichlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 91965898) has the molecular formula C22H17Cl2N3S and a molecular weight of 426.37 g/mol. Its IUPAC name is 10-benzyl-N-(2,4-dichlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | 10-benzyl-N-(2,4-dichlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 91965898 |
| Molecular Formula | C22H17Cl2N3S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 10-benzyl-N-(2,4-dichlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Clc1ccc(Nc2nc(Cc3ccccc3)nc3sc4c(c23)CCC4)c(Cl)c1 |
| InChI | InChI=1S/C22H17Cl2N3S/c23-14-9-10-17(16(24)12-14)25-21-20-15-7-4-8-18(15)28-22(20)27-19(26-21)11-13-5-2-1-3-6-13/h1-3,5-6,9-10,12H,4,7-8,11H2,(H,25,26,27) |
| InChIKey | YVCXNLPQPMCIEW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |