C21H23N3O2S2 — CID 91966024
2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 91966024) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 91966024 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(Nc1nc(Cc2ccccc2)nc2sc3c(c12)CCC3)C(=O)O |
| InChI | InChI=1S/C21H23N3O2S2/c1-27-11-10-15(21(25)26)22-19-18-14-8-5-9-16(14)28-20(18)24-17(23-19)12-13-6-3-2-4-7-13/h2-4,6-7,15H,5,8-12H2,1H3,(H,25,26)(H,22,23,24) |
| InChIKey | LSEBVDIJFGRKLN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |