C23H21N3OS — CID 91965912
2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylphenol (PubChem CID 91965912) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylphenol.
| Compound Name | 2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylphenol |
|---|---|
| PubChem CID | 91965912 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[(10-benzyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]-4-methylphenol |
| SMILES | Cc1ccc(O)c(Nc2nc(Cc3ccccc3)nc3sc4c(c23)CCC4)c1 |
| InChI | InChI=1S/C23H21N3OS/c1-14-10-11-18(27)17(12-14)24-22-21-16-8-5-9-19(16)28-23(21)26-20(25-22)13-15-6-3-2-4-7-15/h2-4,6-7,10-12,27H,5,8-9,13H2,1H3,(H,24,25,26) |
| InChIKey | JMXSUNXLPLTUAE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|