C26H39NO8 — CID 24829808
3-O-tert-butyl 5-O-(2,2-dimethylpropanoyl) (4S,5R)-2-(2,4-dimethoxyphenyl)-4-(2-methylpropyl)-1,3-oxazolidine-3,5-dicarboxylate (PubChem CID 24829808) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-O-tert-butyl 5-O-(2,2-dimethylpropanoyl) (4S,5R)-2-(2,4-dimethoxyphenyl)-4-(2-methylpropyl)-1,3-oxazolidine-3,5-dicarboxylate.
| Compound Name | 3-O-tert-butyl 5-O-(2,2-dimethylpropanoyl) (4S,5R)-2-(2,4-dimethoxyphenyl)-4-(2-methylpropyl)-1,3-oxazolidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24829808 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 3-O-tert-butyl 5-O-(2,2-dimethylpropanoyl) (4S,5R)-2-(2,4-dimethoxyphenyl)-4-(2-methylpropyl)-1,3-oxazolidine-3,5-dicarboxylate |
| SMILES | COc1ccc(C2O[C@@H](C(=O)OC(=O)C(C)(C)C)[C@H](CC(C)C)N2C(=O)OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C26H39NO8/c1-15(2)13-18-20(22(28)34-23(29)25(3,4)5)33-21(27(18)24(30)35-26(6,7)8)17-12-11-16(31-9)14-19(17)32-10/h11-12,14-15,18,20-21H,13H2,1-10H3/t18-,20+,21?/m0/s1 |
| InChIKey | ZNMBXGCNSUYHJK-PALXJHBUSA-N |
| XLogP | 4.87 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|