C17H22BNO6 — CID 59245129
CID 59245129 (PubChem CID 59245129) has the molecular formula C17H22BNO6 and a molecular weight of 347.18 g/mol.
| Compound Name | CID 59245129 |
|---|---|
| PubChem CID | 59245129 |
| Molecular Formula | C17H22BNO6 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N1C(c2ccc(OC)cc2OC)OC(C(=O)O)[C@@H]1CC(C)C |
| InChI | InChI=1S/C17H22BNO6/c1-9(2)7-12-14(16(20)21)25-15(19(12)17(18)22)11-6-5-10(23-3)8-13(11)24-4/h5-6,8-9,12,14-15H,7H2,1-4H3,(H,20,21)/t12-,14?,15?/m0/s1 |
| InChIKey | WXPABHMFMNMHPG-GRTSSRMGSA-N |
| XLogP | 2.19 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|