C23H31N3O6 — CID 67763359
butylurea;2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylic acid (PubChem CID 67763359) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is butylurea;2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylic acid.
| Compound Name | butylurea;2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 67763359 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | butylurea;2-(2,4-dimethoxyphenyl)-4-phenyl-1,3-oxazolidine-5-carboxylic acid |
| SMILES | CCCCNC(N)=O.COc1ccc(C2NC(c3ccccc3)C(C(=O)O)O2)c(OC)c1 |
| InChI | InChI=1S/C18H19NO5.C5H12N2O/c1-22-12-8-9-13(14(10-12)23-2)17-19-15(16(24-17)18(20)21)11-6-4-3-5-7-11;1-2-3-4-7-5(6)8/h3-10,15-17,19H,1-2H3,(H,20,21);2-4H2,1H3,(H3,6,7,8) |
| InChIKey | DWCIMLQTGNLEHV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|