C19H23N3O3 — CID 75283665
N-benzyl-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 75283665) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-benzyl-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-benzyl-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75283665 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-benzyl-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | COc1ccc(C2CC(C(=O)NCc3ccccc3)NN2)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-24-14-8-9-15(18(10-14)25-2)16-11-17(22-21-16)19(23)20-12-13-6-4-3-5-7-13/h3-10,16-17,21-22H,11-12H2,1-2H3,(H,20,23) |
| InChIKey | PWABRTRVFARXJW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |