C22H29N3O5 — CID 75254984
N-(2,5-diethoxyphenyl)-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide (PubChem CID 75254984) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide.
| Compound Name | N-(2,5-diethoxyphenyl)-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75254984 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-5-(2,4-dimethoxyphenyl)pyrazolidine-3-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)C2CC(c3ccc(OC)cc3OC)NN2)c1 |
| InChI | InChI=1S/C22H29N3O5/c1-5-29-15-8-10-20(30-6-2)18(11-15)23-22(26)19-13-17(24-25-19)16-9-7-14(27-3)12-21(16)28-4/h7-12,17,19,24-25H,5-6,13H2,1-4H3,(H,23,26) |
| InChIKey | CXQYGHUYLIPNOL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |