C19H23N3O3 — CID 75254961
5-(2,4-dimethoxyphenyl)-N-(2-methylphenyl)pyrazolidine-3-carboxamide (PubChem CID 75254961) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-N-(2-methylphenyl)pyrazolidine-3-carboxamide.
| Compound Name | 5-(2,4-dimethoxyphenyl)-N-(2-methylphenyl)pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 75254961 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-N-(2-methylphenyl)pyrazolidine-3-carboxamide |
| SMILES | COc1ccc(C2CC(C(=O)Nc3ccccc3C)NN2)c(OC)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-12-6-4-5-7-15(12)20-19(23)17-11-16(21-22-17)14-9-8-13(24-2)10-18(14)25-3/h4-10,16-17,21-22H,11H2,1-3H3,(H,20,23) |
| InChIKey | IJJVKRASPWPNOQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |