C23H30N4O3 — CID 75283629
[5-(2,4-dimethoxyphenyl)pyrazolidin-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone (PubChem CID 75283629) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is [5-(2,4-dimethoxyphenyl)pyrazolidin-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | [5-(2,4-dimethoxyphenyl)pyrazolidin-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 75283629 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | [5-(2,4-dimethoxyphenyl)pyrazolidin-3-yl]-[4-(4-methylphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C2CC(C(=O)N3CCN(c4ccc(C)cc4)CC3)NN2)c(OC)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-16-4-6-17(7-5-16)26-10-12-27(13-11-26)23(28)21-15-20(24-25-21)19-9-8-18(29-2)14-22(19)30-3/h4-9,14,20-21,24-25H,10-13,15H2,1-3H3 |
| InChIKey | FYAJMLNACZHQDI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|