C23H27Cl2NO2 — CID 24834803
(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) 2-chloro-2,2-diphenylacetate;hydrochloride (PubChem CID 24834803) has the molecular formula C23H27Cl2NO2 and a molecular weight of 420.38 g/mol. Its IUPAC name is (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) 2-chloro-2,2-diphenylacetate;hydrochloride.
| Compound Name | (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) 2-chloro-2,2-diphenylacetate;hydrochloride |
|---|---|
| PubChem CID | 24834803 |
| Molecular Formula | C23H27Cl2NO2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (9-methyl-9-azabicyclo[3.3.1]nonan-3-yl) 2-chloro-2,2-diphenylacetate;hydrochloride |
| SMILES | CN1C2CCCC1CC(OC(=O)C(Cl)(c1ccccc1)c1ccccc1)C2.Cl |
| InChI | InChI=1S/C23H26ClNO2.ClH/c1-25-19-13-8-14-20(25)16-21(15-19)27-22(26)23(24,17-9-4-2-5-10-17)18-11-6-3-7-12-18;/h2-7,9-12,19-21H,8,13-16H2,1H3;1H |
| InChIKey | KRJATBMNCRRHQB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|