C19H20FNO4S — CID 2483482
[4-(4-fluorophenyl)-4-oxobutyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 2483482) has the molecular formula C19H20FNO4S and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2483482 |
| Molecular Formula | C19H20FNO4S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc(C)c(C)c1C(=O)OCCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO4S/c1-11-12(2)26-18(21-13(3)22)17(11)19(24)25-10-4-5-16(23)14-6-8-15(20)9-7-14/h6-9H,4-5,10H2,1-3H3,(H,21,22) |
| InChIKey | TXMLVLWDOSLAEJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|