C17H17N3O6S — CID 2483626
[2-(3-nitroanilino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate (PubChem CID 2483626) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 2483626 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 2-acetamido-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CC(=O)Nc1sc(C)c(C)c1C(=O)OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17N3O6S/c1-9-10(2)27-16(18-11(3)21)15(9)17(23)26-8-14(22)19-12-5-4-6-13(7-12)20(24)25/h4-7H,8H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | VVQMODCMSFMWDH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|