C19H18FN3O6S — CID 32750569
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate (PubChem CID 32750569) has the molecular formula C19H18FN3O6S and a molecular weight of 435.43 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 32750569 |
| Molecular Formula | C19H18FN3O6S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate |
| SMILES | Cc1sc(NC(=O)C2CC2)c(C(=O)OCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C19H18FN3O6S/c1-9-10(2)30-18(22-17(25)11-3-4-11)16(9)19(26)29-8-15(24)21-12-5-6-13(20)14(7-12)23(27)28/h5-7,11H,3-4,8H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | OIYQQKHOCQXEOL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|