C14H13FN4O5S — CID 24528025
[2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 24528025) has the molecular formula C14H13FN4O5S and a molecular weight of 368.35 g/mol. Its IUPAC name is [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 24528025 |
| Molecular Formula | C14H13FN4O5S |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [2-(4-fluoro-3-nitroanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CNc1snc(C)c1C(=O)OCC(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13FN4O5S/c1-7-12(13(16-2)25-18-7)14(21)24-6-11(20)17-8-3-4-9(15)10(5-8)19(22)23/h3-5,16H,6H2,1-2H3,(H,17,20) |
| InChIKey | MANWJSUIDLLDAW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|