C18H24N4O3S — CID 24528020
[2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 24528020) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is [2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 24528020 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [2-[4-(diethylamino)anilino]-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CCN(CC)c1ccc(NC(=O)COC(=O)c2c(C)nsc2NC)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-5-22(6-2)14-9-7-13(8-10-14)20-15(23)11-25-18(24)16-12(3)21-26-17(16)19-4/h7-10,19H,5-6,11H2,1-4H3,(H,20,23) |
| InChIKey | USBLGYDDCCATCJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|