C15H16N4O4S — CID 27195157
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 27195157) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 27195157 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CNc1snc(C)c1C(=O)OCC(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16N4O4S/c1-9-12(14(16-2)24-19-9)15(22)23-8-11(20)17-18-13(21)10-6-4-3-5-7-10/h3-7,16H,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | XPRZVUNYGRTKHR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|