C13H22N2O5S — CID 104562922
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 104562922) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 104562922 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CNc1snc(C)c1C(=O)OCCOCCOCCOC |
| InChI | InChI=1S/C13H22N2O5S/c1-10-11(12(14-2)21-15-10)13(16)20-9-8-19-7-6-18-5-4-17-3/h14H,4-9H2,1-3H3 |
| InChIKey | MJLRQOSCLGFDDC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|