About 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate
3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 113221509) has the molecular formula C12H20N2O2S
and a molecular weight of 256.37 g/mol. Its IUPAC name is 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| PubChem CID | 113221509 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CNc1snc(C)c1C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C12H20N2O2S/c1-8-9(10(13-5)17-14-8)11(15)16-7-6-12(2,3)4/h13H,6-7H2,1-5H3 |
| InChIKey | DOVRENFIMCYTNK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate?
The IUPAC name of 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (CID 113221509) is 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
What is the SMILES notation for 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate?
The canonical SMILES for 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate is CNc1snc(C)c1C(=O)OCCC(C)(C)C.
What is the InChIKey of 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate?
The InChIKey is DOVRENFIMCYTNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S/c1-8-9(10(13-5)17-14-8)11(15)16-7-6-12(2,3)4/h13H,6-7H2,1-5H3.
What are the key properties of 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate?
3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate has a molecular weight of 256.37 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 113221509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).