C15H15N3O3S — CID 24528018
2-(4-cyanophenoxy)ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 24528018) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | 2-(4-cyanophenoxy)ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 24528018 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(4-cyanophenoxy)ethyl 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CNc1snc(C)c1C(=O)OCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H15N3O3S/c1-10-13(14(17-2)22-18-10)15(19)21-8-7-20-12-5-3-11(9-16)4-6-12/h3-6,17H,7-8H2,1-2H3 |
| InChIKey | NUPZLSYKXWBEEG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|