C14H14IN3O3S — CID 24528032
[2-(3-iodoanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate (PubChem CID 24528032) has the molecular formula C14H14IN3O3S and a molecular weight of 431.26 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 24528032 |
| Molecular Formula | C14H14IN3O3S |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.98 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 3-methyl-5-(methylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CNc1snc(C)c1C(=O)OCC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C14H14IN3O3S/c1-8-12(13(16-2)22-18-8)14(20)21-7-11(19)17-10-5-3-4-9(15)6-10/h3-6,16H,7H2,1-2H3,(H,17,19) |
| InChIKey | OCLDXDVEGGTMTI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|