C14H13IN2O4 — CID 7548746
[2-(3-iodoanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate (PubChem CID 7548746) has the molecular formula C14H13IN2O4 and a molecular weight of 400.17 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 7548746 |
| Molecular Formula | C14H13IN2O4 |
| Molecular Weight | 400.17 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 3,5-dimethyl-1,2-oxazole-4-carboxylate |
| SMILES | Cc1noc(C)c1C(=O)OCC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C14H13IN2O4/c1-8-13(9(2)21-17-8)14(19)20-7-12(18)16-11-5-3-4-10(15)6-11/h3-6H,7H2,1-2H3,(H,16,18) |
| InChIKey | QVKKHXYMNLAPKD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|