About [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate
[2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate (PubChem CID 8014515) has the molecular formula C12H14INO4
and a molecular weight of 363.15 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate.
Molecular Properties
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate |
| PubChem CID | 8014515 |
| Molecular Formula | C12H14INO4 |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C12H14INO4/c1-2-17-8-12(16)18-7-11(15)14-10-5-3-4-9(13)6-10/h3-6H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | RJSKCVXFJHJNIL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate?
The IUPAC name of [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate (CID 8014515) is [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate.
What is the SMILES notation for [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate?
The canonical SMILES for [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate is CCOCC(=O)OCC(=O)Nc1cccc(I)c1.
What is the InChIKey of [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate?
The InChIKey is RJSKCVXFJHJNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14INO4/c1-2-17-8-12(16)18-7-11(15)14-10-5-3-4-9(13)6-10/h3-6H,2,7-8H2,1H3,(H,14,15).
What are the key properties of [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate?
[2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate has a molecular weight of 363.15 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3-iodoanilino)-2-oxoethyl] 2-ethoxyacetate is sourced from PubChem (CID 8014515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).