C16H16IN3O3S — CID 40782717
[2-(3-iodoanilino)-2-oxoethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate (PubChem CID 40782717) has the molecular formula C16H16IN3O3S and a molecular weight of 457.29 g/mol. Its IUPAC name is [2-(3-iodoanilino)-2-oxoethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate.
| Compound Name | [2-(3-iodoanilino)-2-oxoethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 40782717 |
| Molecular Formula | C16H16IN3O3S |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | [2-(3-iodoanilino)-2-oxoethyl] 2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetate |
| SMILES | Cc1cc(C)nc(SCC(=O)OCC(=O)Nc2cccc(I)c2)n1 |
| InChI | InChI=1S/C16H16IN3O3S/c1-10-6-11(2)19-16(18-10)24-9-15(22)23-8-14(21)20-13-5-3-4-12(17)7-13/h3-7H,8-9H2,1-2H3,(H,20,21) |
| InChIKey | YLCRZVDLACQCRI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|