C19H17Cl3N2O4S — CID 55377693
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate (PubChem CID 55377693) has the molecular formula C19H17Cl3N2O4S and a molecular weight of 475.78 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 55377693 |
| Molecular Formula | C19H17Cl3N2O4S |
| Molecular Weight | 475.78 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-(cyclopropanecarbonylamino)-4,5-dimethylthiophene-3-carboxylate |
| SMILES | Cc1sc(NC(=O)C2CC2)c(C(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C19H17Cl3N2O4S/c1-8-9(2)29-18(24-17(26)10-3-4-10)16(8)19(27)28-7-15(25)23-14-6-12(21)11(20)5-13(14)22/h5-6,10H,3-4,7H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | COUBFDGAZIMNKQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.78 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|