About [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide
[(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide (PubChem CID 24837068) has the molecular formula C22H36BrNO2
and a molecular weight of 426.44 g/mol. Its IUPAC name is [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide.
Molecular Properties
| Compound Name | [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide |
| PubChem CID | 24837068 |
| Molecular Formula | C22H36BrNO2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide |
| SMILES | CCCCCC[N+](C)(C)C[C@@H]1CCCC[C@H]1OC(=O)c1ccccc1.[Br-] |
| InChI | InChI=1S/C22H36NO2.BrH/c1-4-5-6-12-17-23(2,3)18-20-15-10-11-16-21(20)25-22(24)19-13-8-7-9-14-19;/h7-9,13-14,20-21H,4-6,10-12,15-18H2,1-3H3;1H/q+1;/p-1/t20-,21+;/m0./s1 |
| InChIKey | OUMMLYIYUKXASN-JUDYQFGCSA-M |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide?
The IUPAC name of [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide (CID 24837068) is [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide.
What is the SMILES notation for [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide?
The canonical SMILES for [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide is CCCCCC[N+](C)(C)C[C@@H]1CCCC[C@H]1OC(=O)c1ccccc1.[Br-].
What is the InChIKey of [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide?
The InChIKey is OUMMLYIYUKXASN-JUDYQFGCSA-M. The full InChI is InChI=1S/C22H36NO2.BrH/c1-4-5-6-12-17-23(2,3)18-20-15-10-11-16-21(20)25-22(24)19-13-8-7-9-14-19;/h7-9,13-14,20-21H,4-6,10-12,15-18H2,1-3H3;1H/q+1;/p-1/t20-,21+;/m0./s1.
What are the key properties of [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide?
[(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide has a molecular weight of 426.44 g/mol, XLogP of 2.06, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-benzoyloxycyclohexyl]methyl-hexyl-dimethylazanium bromide is sourced from PubChem (CID 24837068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).