C21H30O4 — CID 24837239
2,2,3-trimethyl-3-(5-phenylpentoxycarbonyl)cyclopentane-1-carboxylic acid (PubChem CID 24837239) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(5-phenylpentoxycarbonyl)cyclopentane-1-carboxylic acid.
| Compound Name | 2,2,3-trimethyl-3-(5-phenylpentoxycarbonyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 24837239 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 2,2,3-trimethyl-3-(5-phenylpentoxycarbonyl)cyclopentane-1-carboxylic acid |
| SMILES | CC1(C(=O)OCCCCCc2ccccc2)CCC(C(=O)O)C1(C)C |
| InChI | InChI=1S/C21H30O4/c1-20(2)17(18(22)23)13-14-21(20,3)19(24)25-15-9-5-8-12-16-10-6-4-7-11-16/h4,6-7,10-11,17H,5,8-9,12-15H2,1-3H3,(H,22,23) |
| InChIKey | NHJSTRPEDUDKLT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|