About 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride
2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride (PubChem CID 24838005) has the molecular formula C21H39ClN2O3
and a molecular weight of 403.01 g/mol. Its IUPAC name is 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride |
| PubChem CID | 24838005 |
| Molecular Formula | C21H39ClN2O3 |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride |
| SMILES | CCCCCCC(C)NCCOC(=O)c1ccc(N(CC)CC)cc1.Cl.O |
| InChI | InChI=1S/C21H36N2O2.ClH.H2O/c1-5-8-9-10-11-18(4)22-16-17-25-21(24)19-12-14-20(15-13-19)23(6-2)7-3;;/h12-15,18,22H,5-11,16-17H2,1-4H3;1H;1H2 |
| InChIKey | QLVBHOQKQJCXSJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride?
The IUPAC name of 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride (CID 24838005) is 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride.
What is the SMILES notation for 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride?
The canonical SMILES for 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride is CCCCCCC(C)NCCOC(=O)c1ccc(N(CC)CC)cc1.Cl.O.
What is the InChIKey of 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride?
The InChIKey is QLVBHOQKQJCXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O2.ClH.H2O/c1-5-8-9-10-11-18(4)22-16-17-25-21(24)19-12-14-20(15-13-19)23(6-2)7-3;;/h12-15,18,22H,5-11,16-17H2,1-4H3;1H;1H2.
What are the key properties of 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride?
2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride has a molecular weight of 403.01 g/mol, XLogP of 4.24, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(octan-2-ylamino)ethyl 4-(diethylamino)benzoate;hydrate;hydrochloride is sourced from PubChem (CID 24838005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).