C17H20N2O — CID 24838234
N'-cyclohexyl-N-phenylfuran-2-carboximidamide (PubChem CID 24838234) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is N'-cyclohexyl-N-phenylfuran-2-carboximidamide.
| Compound Name | N'-cyclohexyl-N-phenylfuran-2-carboximidamide |
|---|---|
| PubChem CID | 24838234 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N'-cyclohexyl-N-phenylfuran-2-carboximidamide |
| SMILES | c1ccc(N/C(=N/C2CCCCC2)c2ccco2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-3-8-14(9-4-1)18-17(16-12-7-13-20-16)19-15-10-5-2-6-11-15/h1,3-4,7-9,12-13,15H,2,5-6,10-11H2,(H,18,19) |
| InChIKey | QIVSTJLBVTUEPX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|