C12H12F7N2O+ — CID 2484056
[(2R)-1,1,1,2-tetrafluoro-3-oxo-3-[[(1S)-1-phenylethyl]amino]propan-2-yl]-(trifluoromethyl)azanium (PubChem CID 2484056) has the molecular formula C12H12F7N2O+ and a molecular weight of 333.23 g/mol. Its IUPAC name is [(2R)-1,1,1,2-tetrafluoro-3-oxo-3-[[(1S)-1-phenylethyl]amino]propan-2-yl]-(trifluoromethyl)azanium.
| Compound Name | [(2R)-1,1,1,2-tetrafluoro-3-oxo-3-[[(1S)-1-phenylethyl]amino]propan-2-yl]-(trifluoromethyl)azanium |
|---|---|
| PubChem CID | 2484056 |
| Molecular Formula | C12H12F7N2O+ |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [(2R)-1,1,1,2-tetrafluoro-3-oxo-3-[[(1S)-1-phenylethyl]amino]propan-2-yl]-(trifluoromethyl)azanium |
| SMILES | C[C@H](NC(=O)[C@](F)([NH2+]C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H11F7N2O/c1-7(8-5-3-2-4-6-8)20-9(22)10(13,11(14,15)16)21-12(17,18)19/h2-7,21H,1H3,(H,20,22)/p+1/t7-,10-/m0/s1 |
| InChIKey | WGNUDVQAHOGFJX-XVKPBYJWSA-O |
| XLogP | 2.18 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|