C6H6O3 — CID 24840946
prop-1-ene-1,1,3-tricarbaldehyde (PubChem CID 24840946) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is prop-1-ene-1,1,3-tricarbaldehyde.
| Compound Name | prop-1-ene-1,1,3-tricarbaldehyde |
|---|---|
| PubChem CID | 24840946 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | prop-1-ene-1,1,3-tricarbaldehyde |
| SMILES | O=CCC=C(C=O)C=O |
| InChI | InChI=1S/C6H6O3/c7-3-1-2-6(4-8)5-9/h2-5H,1H2 |
| InChIKey | XGMOGZJJTWXFNS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|